C12H16O — CID 140977539
cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol (PubChem CID 140977539) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol.
| Compound Name | cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol |
|---|---|
| PubChem CID | 140977539 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol |
| SMILES | OC(=C1C=CC=C1)C1CCCCC1 |
| InChI | InChI=1S/C12H16O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2 |
| InChIKey | FZTSIWIUWXGRCM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|