About cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol
cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol (PubChem CID 140977539) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol.
Molecular Properties
| Compound Name | cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol |
| PubChem CID | 140977539 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol |
| SMILES | OC(=C1C=CC=C1)C1CCCCC1 |
| InChI | InChI=1S/C12H16O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2 |
| InChIKey | FZTSIWIUWXGRCM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol?
The IUPAC name of cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol (CID 140977539) is cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol.
What is the SMILES notation for cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol?
The canonical SMILES for cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol is OC(=C1C=CC=C1)C1CCCCC1.
What is the InChIKey of cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol?
The InChIKey is FZTSIWIUWXGRCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2.
What are the key properties of cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol?
cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol has a molecular weight of 176.26 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(cyclopenta-2,4-dien-1-ylidene)methanol is sourced from PubChem (CID 140977539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).