About dizinc;benzoate;hydroxide
dizinc;benzoate;hydroxide (PubChem CID 157317749) has the molecular formula C7H6O3Zn2+2
and a molecular weight of 268.90 g/mol. Its IUPAC name is dizinc;benzoate;hydroxide.
Molecular Properties
| Compound Name | dizinc;benzoate;hydroxide |
| PubChem CID | 157317749 |
| Molecular Formula | C7H6O3Zn2+2 |
| Molecular Weight | 268.90 g/mol |
| Exact Mass | 265.89 |
| IUPAC Name | dizinc;benzoate;hydroxide |
| SMILES | O=C([O-])c1ccccc1.[OH-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C7H6O2.H2O.2Zn/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H,(H,8,9);1H2;;/q;;2*+2/p-2 |
| InChIKey | YSZJKLDUOLXECA-UHFFFAOYSA-L |
| XLogP | -0.13 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.90 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dizinc;benzoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dizinc;benzoate;hydroxide?
The IUPAC name of dizinc;benzoate;hydroxide (CID 157317749) is dizinc;benzoate;hydroxide.
What is the SMILES notation for dizinc;benzoate;hydroxide?
The canonical SMILES for dizinc;benzoate;hydroxide is O=C([O-])c1ccccc1.[OH-].[Zn+2].[Zn+2].
What is the InChIKey of dizinc;benzoate;hydroxide?
The InChIKey is YSZJKLDUOLXECA-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O2.H2O.2Zn/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H,(H,8,9);1H2;;/q;;2*+2/p-2.
What are the key properties of dizinc;benzoate;hydroxide?
dizinc;benzoate;hydroxide has a molecular weight of 268.90 g/mol, XLogP of -0.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dizinc;benzoate;hydroxide is sourced from PubChem (CID 157317749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).