C14H11BrN2S2 — CID 3709213
2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile (PubChem CID 3709213) has the molecular formula C14H11BrN2S2 and a molecular weight of 351.29 g/mol. Its IUPAC name is 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile.
| Compound Name | 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 3709213 |
| Molecular Formula | C14H11BrN2S2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile |
| SMILES | CSC(SC)=C(Br)C(=C(C#N)C#N)c1ccccc1 |
| InChI | InChI=1S/C14H11BrN2S2/c1-18-14(19-2)13(15)12(11(8-16)9-17)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | VTAUVQYANXPMBB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|