About 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile
2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile (PubChem CID 3709213) has the molecular formula C14H11BrN2S2
and a molecular weight of 351.29 g/mol. Its IUPAC name is 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile |
| PubChem CID | 3709213 |
| Molecular Formula | C14H11BrN2S2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile |
| SMILES | CSC(SC)=C(Br)C(=C(C#N)C#N)c1ccccc1 |
| InChI | InChI=1S/C14H11BrN2S2/c1-18-14(19-2)13(15)12(11(8-16)9-17)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | VTAUVQYANXPMBB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile?
The IUPAC name of 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile (CID 3709213) is 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile.
What is the SMILES notation for 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile?
The canonical SMILES for 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile is CSC(SC)=C(Br)C(=C(C#N)C#N)c1ccccc1.
What is the InChIKey of 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile?
The InChIKey is VTAUVQYANXPMBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN2S2/c1-18-14(19-2)13(15)12(11(8-16)9-17)10-6-4-3-5-7-10/h3-7H,1-2H3.
What are the key properties of 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile?
2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile has a molecular weight of 351.29 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-3,3-bis(methylsulfanyl)-1-phenylprop-2-enylidene]propanedinitrile is sourced from PubChem (CID 3709213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).