C18H13N3S — CID 10063565
methyl N-(2,2-dicyano-1-phenylethenyl)benzenecarboximidothioate (PubChem CID 10063565) has the molecular formula C18H13N3S and a molecular weight of 303.39 g/mol. Its IUPAC name is methyl N-(2,2-dicyano-1-phenylethenyl)benzenecarboximidothioate.
| Compound Name | methyl N-(2,2-dicyano-1-phenylethenyl)benzenecarboximidothioate |
|---|---|
| PubChem CID | 10063565 |
| Molecular Formula | C18H13N3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl N-(2,2-dicyano-1-phenylethenyl)benzenecarboximidothioate |
| SMILES | CS/C(=N\C(=C(C#N)C#N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H13N3S/c1-22-18(15-10-6-3-7-11-15)21-17(16(12-19)13-20)14-8-4-2-5-9-14/h2-11H,1H3/b21-18- |
| InChIKey | FKVXFUNBLKUCHU-UZYVYHOESA-N |
| XLogP | 4.25 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|