C9H5Br2N — CID 54113600
2,3-dibromo-3-phenylprop-2-enenitrile (PubChem CID 54113600) has the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. Its IUPAC name is 2,3-dibromo-3-phenylprop-2-enenitrile.
| Compound Name | 2,3-dibromo-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 54113600 |
| Molecular Formula | C9H5Br2N |
| Molecular Weight | 286.95 g/mol |
| Exact Mass | 284.88 |
| IUPAC Name | 2,3-dibromo-3-phenylprop-2-enenitrile |
| SMILES | N#CC(Br)=C(Br)c1ccccc1 |
| InChI | InChI=1S/C9H5Br2N/c10-8(6-12)9(11)7-4-2-1-3-5-7/h1-5H |
| InChIKey | NIUCTUFOAIZUPV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|