C38H23N7 — CID 101379213
2-phenyl-3-[4-[[4-(N-phenylanilino)phenyl]diazenyl]phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile (PubChem CID 101379213) has the molecular formula C38H23N7 and a molecular weight of 577.65 g/mol. Its IUPAC name is 2-phenyl-3-[4-[[4-(N-phenylanilino)phenyl]diazenyl]phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile.
| Compound Name | 2-phenyl-3-[4-[[4-(N-phenylanilino)phenyl]diazenyl]phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 101379213 |
| Molecular Formula | C38H23N7 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 2-phenyl-3-[4-[[4-(N-phenylanilino)phenyl]diazenyl]phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
| SMILES | N#CC(C#N)=C(C(=C(C#N)C#N)c1ccc(/N=N/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H23N7/c39-24-30(25-40)37(28-10-4-1-5-11-28)38(31(26-41)27-42)29-16-18-32(19-17-29)43-44-33-20-22-36(23-21-33)45(34-12-6-2-7-13-34)35-14-8-3-9-15-35/h1-23H/b44-43+ |
| InChIKey | MMELINBSJUSXMC-VGFSZAGXSA-N |
| XLogP | 9.87 |
| TPSA | 123.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|