C26H27N5 — CID 22914030
3,3-dicyano-N-[4-(dibutylamino)phenyl]-2-phenylprop-2-enimidoyl cyanide (PubChem CID 22914030) has the molecular formula C26H27N5 and a molecular weight of 409.54 g/mol. Its IUPAC name is 3,3-dicyano-N-[4-(dibutylamino)phenyl]-2-phenylprop-2-enimidoyl cyanide.
| Compound Name | 3,3-dicyano-N-[4-(dibutylamino)phenyl]-2-phenylprop-2-enimidoyl cyanide |
|---|---|
| PubChem CID | 22914030 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 3,3-dicyano-N-[4-(dibutylamino)phenyl]-2-phenylprop-2-enimidoyl cyanide |
| SMILES | CCCCN(CCCC)c1ccc(/N=C(\C#N)C(=C(C#N)C#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N5/c1-3-5-16-31(17-6-4-2)24-14-12-23(13-15-24)30-25(20-29)26(22(18-27)19-28)21-10-8-7-9-11-21/h7-15H,3-6,16-17H2,1-2H3/b30-25+ |
| InChIKey | MZSHMKQWGGPDJJ-QCWLDUFUSA-N |
| XLogP | 6.19 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|