C38H48N4 — CID 19010194
2-[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile (PubChem CID 19010194) has the molecular formula C38H48N4 and a molecular weight of 560.83 g/mol. Its IUPAC name is 2-[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile.
| Compound Name | 2-[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 19010194 |
| Molecular Formula | C38H48N4 |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | 2-[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(C(c2ccc(N(CCCC)CCCC)cc2)=c2ccc(=C(C#N)C#N)cc2)cc1 |
| InChI | InChI=1S/C38H48N4/c1-5-9-25-41(26-10-6-2)36-21-17-33(18-22-36)38(32-15-13-31(14-16-32)35(29-39)30-40)34-19-23-37(24-20-34)42(27-11-7-3)28-12-8-4/h13-24H,5-12,25-28H2,1-4H3 |
| InChIKey | UJRZYWLSYMTUNO-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|