C30H44N4 — CID 160774709
4-[bis(2-methylpropyl)amino]benzonitrile;4-(dibutylamino)benzonitrile (PubChem CID 160774709) has the molecular formula C30H44N4 and a molecular weight of 460.71 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)amino]benzonitrile;4-(dibutylamino)benzonitrile.
| Compound Name | 4-[bis(2-methylpropyl)amino]benzonitrile;4-(dibutylamino)benzonitrile |
|---|---|
| PubChem CID | 160774709 |
| Molecular Formula | C30H44N4 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 4-[bis(2-methylpropyl)amino]benzonitrile;4-(dibutylamino)benzonitrile |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C#N)cc1.CCCCN(CCCC)c1ccc(C#N)cc1 |
| InChI | InChI=1S/2C15H22N2/c1-12(2)10-17(11-13(3)4)15-7-5-14(9-16)6-8-15;1-3-5-11-17(12-6-4-2)15-9-7-14(13-16)8-10-15/h5-8,12-13H,10-11H2,1-4H3;7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | RZUFLWWGLZWRGY-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |