C33H33N3 — CID 101172527
4-[5-[4-(dibutylamino)phenyl]-3H-benzo[e]indol-2-yl]benzonitrile (PubChem CID 101172527) has the molecular formula C33H33N3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-[5-[4-(dibutylamino)phenyl]-3H-benzo[e]indol-2-yl]benzonitrile.
| Compound Name | 4-[5-[4-(dibutylamino)phenyl]-3H-benzo[e]indol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 101172527 |
| Molecular Formula | C33H33N3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 4-[5-[4-(dibutylamino)phenyl]-3H-benzo[e]indol-2-yl]benzonitrile |
| SMILES | CCCCN(CCCC)c1ccc(-c2cc3[nH]c(-c4ccc(C#N)cc4)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C33H33N3/c1-3-5-19-36(20-6-4-2)27-17-15-25(16-18-27)30-21-33-31(29-10-8-7-9-28(29)30)22-32(35-33)26-13-11-24(23-34)12-14-26/h7-18,21-22,35H,3-6,19-20H2,1-2H3 |
| InChIKey | DNBDMDQOJYOGPN-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |