C54H64N2 — CID 102510045
N,N-dibutyl-4-[5-[4-(dibutylamino)phenyl]-1,4,8,11-tetramethylnaphtho[1,2-b]phenanthren-12-yl]aniline (PubChem CID 102510045) has the molecular formula C54H64N2 and a molecular weight of 741.12 g/mol. Its IUPAC name is N,N-dibutyl-4-[5-[4-(dibutylamino)phenyl]-1,4,8,11-tetramethylnaphtho[1,2-b]phenanthren-12-yl]aniline.
| Compound Name | N,N-dibutyl-4-[5-[4-(dibutylamino)phenyl]-1,4,8,11-tetramethylnaphtho[1,2-b]phenanthren-12-yl]aniline |
|---|---|
| PubChem CID | 102510045 |
| Molecular Formula | C54H64N2 |
| Molecular Weight | 741.12 g/mol |
| Exact Mass | 740.51 |
| IUPAC Name | N,N-dibutyl-4-[5-[4-(dibutylamino)phenyl]-1,4,8,11-tetramethylnaphtho[1,2-b]phenanthren-12-yl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(-c2cc3cc4c(cc(-c5ccc(N(CCCC)CCCC)cc5)c5c(C)ccc(C)c54)cc3c3c(C)ccc(C)c23)cc1 |
| InChI | InChI=1S/C54H64N2/c1-9-13-29-55(30-14-10-2)45-25-21-41(22-26-45)47-33-43-35-50-44(36-49(43)53-39(7)19-17-37(5)51(47)53)34-48(52-38(6)18-20-40(8)54(50)52)42-23-27-46(28-24-42)56(31-15-11-3)32-16-12-4/h17-28,33-36H,9-16,29-32H2,1-8H3 |
| InChIKey | IYBHUWABUMHRTM-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.12 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|