C39H56N4 — CID 70580571
3-[2,3-bis[4-(dibutylamino)phenyl]-N,4-dimethylanilino]propanenitrile (PubChem CID 70580571) has the molecular formula C39H56N4 and a molecular weight of 580.91 g/mol. Its IUPAC name is 3-[2,3-bis[4-(dibutylamino)phenyl]-N,4-dimethylanilino]propanenitrile.
| Compound Name | 3-[2,3-bis[4-(dibutylamino)phenyl]-N,4-dimethylanilino]propanenitrile |
|---|---|
| PubChem CID | 70580571 |
| Molecular Formula | C39H56N4 |
| Molecular Weight | 580.91 g/mol |
| Exact Mass | 580.45 |
| IUPAC Name | 3-[2,3-bis[4-(dibutylamino)phenyl]-N,4-dimethylanilino]propanenitrile |
| SMILES | CCCCN(CCCC)c1ccc(-c2c(C)ccc(N(C)CCC#N)c2-c2ccc(N(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C39H56N4/c1-7-11-28-42(29-12-8-2)35-21-17-33(18-22-35)38-32(5)16-25-37(41(6)27-15-26-40)39(38)34-19-23-36(24-20-34)43(30-13-9-3)31-14-10-4/h16-25H,7-15,27-31H2,1-6H3 |
| InChIKey | RCMOIDOGTHOMJV-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.91 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |