[4-[4-(dibutylamino)phenyl]phenyl]boronic acid

C20H28BNO2 — CID 70971873

IUPAC[4-[4-(dibutylamino)phenyl]phenyl]boronic acid
SMILESCCCCN(CCCC)c1ccc(-c2ccc(B(O)O)cc2)cc1
InChIInChI=1S/C20H28BNO2/c1-3-5-15-22(16-6-4-2)20-13-9-18(10-14-20)17-7-11-19(12-8-17)21(23)24/h7-14,23-24H,3-6,15-16H2,1-2H3
InChIKeyYLVHUDFBIAFPFF-UHFFFAOYSA-N
MW325.26 g/mol
LogP3.44
Rot. Bonds9

About [4-[4-(dibutylamino)phenyl]phenyl]boronic acid

[4-[4-(dibutylamino)phenyl]phenyl]boronic acid (PubChem CID 70971873) has the molecular formula C20H28BNO2 and a molecular weight of 325.26 g/mol. Its IUPAC name is [4-[4-(dibutylamino)phenyl]phenyl]boronic acid.

Molecular Properties

Compound Name[4-[4-(dibutylamino)phenyl]phenyl]boronic acid
PubChem CID70971873
Molecular FormulaC20H28BNO2
Molecular Weight325.26 g/mol
Exact Mass325.22
IUPAC Name[4-[4-(dibutylamino)phenyl]phenyl]boronic acid
SMILESCCCCN(CCCC)c1ccc(-c2ccc(B(O)O)cc2)cc1
InChIInChI=1S/C20H28BNO2/c1-3-5-15-22(16-6-4-2)20-13-9-18(10-14-20)17-7-11-19(12-8-17)21(23)24/h7-14,23-24H,3-6,15-16H2,1-2H3
InChIKeyYLVHUDFBIAFPFF-UHFFFAOYSA-N
XLogP3.44
TPSA43.70 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.26
LogP ≤ 53.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-[4-(dibutylamino)phenyl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[4-(dibutylamino)phenyl]phenyl]boronic acid?
The IUPAC name of [4-[4-(dibutylamino)phenyl]phenyl]boronic acid (CID 70971873) is [4-[4-(dibutylamino)phenyl]phenyl]boronic acid.
What is the SMILES notation for [4-[4-(dibutylamino)phenyl]phenyl]boronic acid?
The canonical SMILES for [4-[4-(dibutylamino)phenyl]phenyl]boronic acid is CCCCN(CCCC)c1ccc(-c2ccc(B(O)O)cc2)cc1.
What is the InChIKey of [4-[4-(dibutylamino)phenyl]phenyl]boronic acid?
The InChIKey is YLVHUDFBIAFPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28BNO2/c1-3-5-15-22(16-6-4-2)20-13-9-18(10-14-20)17-7-11-19(12-8-17)21(23)24/h7-14,23-24H,3-6,15-16H2,1-2H3.
What are the key properties of [4-[4-(dibutylamino)phenyl]phenyl]boronic acid?
[4-[4-(dibutylamino)phenyl]phenyl]boronic acid has a molecular weight of 325.26 g/mol, XLogP of 3.44, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(dibutylamino)phenyl]phenyl]boronic acid is sourced from PubChem (CID 70971873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).