C56H76N4 — CID 22095440
4-[[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline (PubChem CID 22095440) has the molecular formula C56H76N4 and a molecular weight of 805.25 g/mol. Its IUPAC name is 4-[[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 22095440 |
| Molecular Formula | C56H76N4 |
| Molecular Weight | 805.25 g/mol |
| Exact Mass | 804.61 |
| IUPAC Name | 4-[[4-[bis[4-(dibutylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline |
| SMILES | CCCCN(CCCC)c1ccc(C(c2ccc(N(CCCC)CCCC)cc2)=c2ccc(=C(c3ccc(N(CC)CC)cc3)c3ccc(N(CC)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H76N4/c1-9-17-41-59(42-18-10-2)53-37-29-49(30-38-53)56(50-31-39-54(40-32-50)60(43-19-11-3)44-20-12-4)46-23-21-45(22-24-46)55(47-25-33-51(34-26-47)57(13-5)14-6)48-27-35-52(36-28-48)58(15-7)16-8/h21-40H,9-20,41-44H2,1-8H3 |
| InChIKey | TVBPFVVECTWARK-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.25 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|