C34H45NO — CID 122582600
4-[(4-decoxyphenyl)-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]-N,N-diethylaniline (PubChem CID 122582600) has the molecular formula C34H45NO and a molecular weight of 483.74 g/mol. Its IUPAC name is 4-[(4-decoxyphenyl)-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]-N,N-diethylaniline.
| Compound Name | 4-[(4-decoxyphenyl)-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 122582600 |
| Molecular Formula | C34H45NO |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | 4-[(4-decoxyphenyl)-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]-N,N-diethylaniline |
| SMILES | C=c1ccc(=C(c2ccc(OCCCCCCCCCC)cc2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C34H45NO/c1-5-8-9-10-11-12-13-14-27-36-33-25-21-31(22-26-33)34(29-17-15-28(4)16-18-29)30-19-23-32(24-20-30)35(6-2)7-3/h15-26H,4-14,27H2,1-3H3 |
| InChIKey | JGPNCMYQEZPZAN-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|