C44H24N8S — CID 122385546
2-(4-carbazol-9-yl-2,1,3-benzothiadiazol-7-yl)-3-[4-(N-phenylanilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile (PubChem CID 122385546) has the molecular formula C44H24N8S and a molecular weight of 696.80 g/mol. Its IUPAC name is 2-(4-carbazol-9-yl-2,1,3-benzothiadiazol-7-yl)-3-[4-(N-phenylanilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile.
| Compound Name | 2-(4-carbazol-9-yl-2,1,3-benzothiadiazol-7-yl)-3-[4-(N-phenylanilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 122385546 |
| Molecular Formula | C44H24N8S |
| Molecular Weight | 696.80 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | 2-(4-carbazol-9-yl-2,1,3-benzothiadiazol-7-yl)-3-[4-(N-phenylanilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
| SMILES | N#CC(C#N)=C(C(=C(C#N)C#N)c1ccc(-n2c3ccccc3c3ccccc32)c2nsnc12)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H24N8S/c45-25-30(26-46)41(29-19-21-34(22-20-29)51(32-11-3-1-4-12-32)33-13-5-2-6-14-33)42(31(27-47)28-48)37-23-24-40(44-43(37)49-53-50-44)52-38-17-9-7-15-35(38)36-16-8-10-18-39(36)52/h1-24H |
| InChIKey | PLLFTYIVEIQWLQ-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 129.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.80 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|