C23H18N4O2 — CID 102408903
methyl (2E)-2,5,5-tricyano-3-[4-(dimethylamino)phenyl]-4-phenylpenta-2,4-dienoate (PubChem CID 102408903) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl (2E)-2,5,5-tricyano-3-[4-(dimethylamino)phenyl]-4-phenylpenta-2,4-dienoate.
| Compound Name | methyl (2E)-2,5,5-tricyano-3-[4-(dimethylamino)phenyl]-4-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 102408903 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | methyl (2E)-2,5,5-tricyano-3-[4-(dimethylamino)phenyl]-4-phenylpenta-2,4-dienoate |
| SMILES | COC(=O)/C(C#N)=C(/C(=C(C#N)C#N)c1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H18N4O2/c1-27(2)19-11-9-17(10-12-19)22(20(15-26)23(28)29-3)21(18(13-24)14-25)16-7-5-4-6-8-16/h4-12H,1-3H3/b22-20+ |
| InChIKey | TXRBCDQYQHIEFI-LSDHQDQOSA-N |
| XLogP | 3.70 |
| TPSA | 100.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|