C31H25N5O2 — CID 102233615
methyl 7-propan-2-yl-3-[1,1,4,4-tetracyano-3-[4-(dimethylamino)phenyl]buta-1,3-dien-2-yl]azulene-1-carboxylate (PubChem CID 102233615) has the molecular formula C31H25N5O2 and a molecular weight of 499.57 g/mol. Its IUPAC name is methyl 7-propan-2-yl-3-[1,1,4,4-tetracyano-3-[4-(dimethylamino)phenyl]buta-1,3-dien-2-yl]azulene-1-carboxylate.
| Compound Name | methyl 7-propan-2-yl-3-[1,1,4,4-tetracyano-3-[4-(dimethylamino)phenyl]buta-1,3-dien-2-yl]azulene-1-carboxylate |
|---|---|
| PubChem CID | 102233615 |
| Molecular Formula | C31H25N5O2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | methyl 7-propan-2-yl-3-[1,1,4,4-tetracyano-3-[4-(dimethylamino)phenyl]buta-1,3-dien-2-yl]azulene-1-carboxylate |
| SMILES | COC(=O)c1cc(C(=C(C#N)C#N)C(=C(C#N)C#N)c2ccc(N(C)C)cc2)c2cccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C31H25N5O2/c1-19(2)21-7-6-8-25-26(13-21)28(31(37)38-5)14-27(25)30(23(17-34)18-35)29(22(15-32)16-33)20-9-11-24(12-10-20)36(3)4/h6-14,19H,1-5H3 |
| InChIKey | XJTGUSGRTNFWED-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 124.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|