C18H23NO2 — CID 11778695
methyl 3-(3-aminopropyl)-7-propan-2-ylazulene-1-carboxylate (PubChem CID 11778695) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is methyl 3-(3-aminopropyl)-7-propan-2-ylazulene-1-carboxylate.
| Compound Name | methyl 3-(3-aminopropyl)-7-propan-2-ylazulene-1-carboxylate |
|---|---|
| PubChem CID | 11778695 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | methyl 3-(3-aminopropyl)-7-propan-2-ylazulene-1-carboxylate |
| SMILES | COC(=O)c1cc(CCCN)c2cccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C18H23NO2/c1-12(2)13-6-4-8-15-14(7-5-9-19)11-17(16(15)10-13)18(20)21-3/h4,6,8,10-12H,5,7,9,19H2,1-3H3 |
| InChIKey | OVJHGDZAXOFLRF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |