C27H27NO4 — CID 11743370
methyl 3-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-propan-2-ylazulene-1-carboxylate (PubChem CID 11743370) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 3-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-propan-2-ylazulene-1-carboxylate.
| Compound Name | methyl 3-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-propan-2-ylazulene-1-carboxylate |
|---|---|
| PubChem CID | 11743370 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | methyl 3-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-propan-2-ylazulene-1-carboxylate |
| SMILES | COC(=O)c1cc(CCCCN2C(=O)c3ccccc3C2=O)c2ccc(C(C)C)ccc1-2 |
| InChI | InChI=1S/C27H27NO4/c1-17(2)18-11-13-20-19(16-24(27(31)32-3)21(20)14-12-18)8-6-7-15-28-25(29)22-9-4-5-10-23(22)26(28)30/h4-5,9-14,16-17H,6-8,15H2,1-3H3 |
| InChIKey | ZEJQVFQJSVSWTA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|