C21H20BrNO5 — CID 135304376
methyl 5-bromo-2-[5-(1,3-dioxoisoindol-2-yl)pentan-2-yloxy]benzoate (PubChem CID 135304376) has the molecular formula C21H20BrNO5 and a molecular weight of 446.30 g/mol. Its IUPAC name is methyl 5-bromo-2-[5-(1,3-dioxoisoindol-2-yl)pentan-2-yloxy]benzoate.
| Compound Name | methyl 5-bromo-2-[5-(1,3-dioxoisoindol-2-yl)pentan-2-yloxy]benzoate |
|---|---|
| PubChem CID | 135304376 |
| Molecular Formula | C21H20BrNO5 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | methyl 5-bromo-2-[5-(1,3-dioxoisoindol-2-yl)pentan-2-yloxy]benzoate |
| SMILES | COC(=O)c1cc(Br)ccc1OC(C)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20BrNO5/c1-13(28-18-10-9-14(22)12-17(18)21(26)27-2)6-5-11-23-19(24)15-7-3-4-8-16(15)20(23)25/h3-4,7-10,12-13H,5-6,11H2,1-2H3 |
| InChIKey | WHZRWLGUARDXQO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|