C21H20Br2N2O5 — CID 67496401
2-[6-(2,6-dibromo-4-nitrophenoxy)heptyl]isoindole-1,3-dione (PubChem CID 67496401) has the molecular formula C21H20Br2N2O5 and a molecular weight of 540.21 g/mol. Its IUPAC name is 2-[6-(2,6-dibromo-4-nitrophenoxy)heptyl]isoindole-1,3-dione.
| Compound Name | 2-[6-(2,6-dibromo-4-nitrophenoxy)heptyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67496401 |
| Molecular Formula | C21H20Br2N2O5 |
| Molecular Weight | 540.21 g/mol |
| Exact Mass | 537.97 |
| IUPAC Name | 2-[6-(2,6-dibromo-4-nitrophenoxy)heptyl]isoindole-1,3-dione |
| SMILES | CC(CCCCCN1C(=O)c2ccccc2C1=O)Oc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C21H20Br2N2O5/c1-13(30-19-17(22)11-14(25(28)29)12-18(19)23)7-3-2-6-10-24-20(26)15-8-4-5-9-16(15)21(24)27/h4-5,8-9,11-13H,2-3,6-7,10H2,1H3 |
| InChIKey | GOEYDAYTXACRON-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.21 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|