C26H26BrN7O7 — CID 143749186
N-[2-amino-5-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]phenyl]acetamide;2-bromo-4,6-dinitroaniline (PubChem CID 143749186) has the molecular formula C26H26BrN7O7 and a molecular weight of 628.44 g/mol. Its IUPAC name is N-[2-amino-5-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]phenyl]acetamide;2-bromo-4,6-dinitroaniline.
| Compound Name | N-[2-amino-5-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]phenyl]acetamide;2-bromo-4,6-dinitroaniline |
|---|---|
| PubChem CID | 143749186 |
| Molecular Formula | C26H26BrN7O7 |
| Molecular Weight | 628.44 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | N-[2-amino-5-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]phenyl]acetamide;2-bromo-4,6-dinitroaniline |
| SMILES | CC(=O)Nc1cc(N(C)CCCN2C(=O)c3ccccc3C2=O)ccc1N.Nc1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O3.C6H4BrN3O4/c1-13(25)22-18-12-14(8-9-17(18)21)23(2)10-5-11-24-19(26)15-6-3-4-7-16(15)20(24)27;7-4-1-3(9(11)12)2-5(6(4)8)10(13)14/h3-4,6-9,12H,5,10-11,21H2,1-2H3,(H,22,25);1-2H,8H2 |
| InChIKey | JOGGBKKYCXVOBK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 208.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|