C25H23BrN6O4 — CID 143749249
2-amino-3-bromo-5-nitrobenzonitrile;2-[2-(4-amino-N,3-dimethylanilino)ethyl]isoindole-1,3-dione (PubChem CID 143749249) has the molecular formula C25H23BrN6O4 and a molecular weight of 551.40 g/mol. Its IUPAC name is 2-amino-3-bromo-5-nitrobenzonitrile;2-[2-(4-amino-N,3-dimethylanilino)ethyl]isoindole-1,3-dione.
| Compound Name | 2-amino-3-bromo-5-nitrobenzonitrile;2-[2-(4-amino-N,3-dimethylanilino)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143749249 |
| Molecular Formula | C25H23BrN6O4 |
| Molecular Weight | 551.40 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 2-amino-3-bromo-5-nitrobenzonitrile;2-[2-(4-amino-N,3-dimethylanilino)ethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N(C)CCN2C(=O)c3ccccc3C2=O)ccc1N.N#Cc1cc([N+](=O)[O-])cc(Br)c1N |
| InChI | InChI=1S/C18H19N3O2.C7H4BrN3O2/c1-12-11-13(7-8-16(12)19)20(2)9-10-21-17(22)14-5-3-4-6-15(14)18(21)23;8-6-2-5(11(12)13)1-4(3-9)7(6)10/h3-8,11H,9-10,19H2,1-2H3;1-2H,10H2 |
| InChIKey | RAOQCWWDFMMHDZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 159.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|