C27H27N7O6 — CID 143749220
2-[4-(4-amino-N,3-dimethylanilino)butyl]isoindole-1,3-dione;2-amino-3,5-dinitrobenzonitrile (PubChem CID 143749220) has the molecular formula C27H27N7O6 and a molecular weight of 545.56 g/mol. Its IUPAC name is 2-[4-(4-amino-N,3-dimethylanilino)butyl]isoindole-1,3-dione;2-amino-3,5-dinitrobenzonitrile.
| Compound Name | 2-[4-(4-amino-N,3-dimethylanilino)butyl]isoindole-1,3-dione;2-amino-3,5-dinitrobenzonitrile |
|---|---|
| PubChem CID | 143749220 |
| Molecular Formula | C27H27N7O6 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 2-[4-(4-amino-N,3-dimethylanilino)butyl]isoindole-1,3-dione;2-amino-3,5-dinitrobenzonitrile |
| SMILES | Cc1cc(N(C)CCCCN2C(=O)c3ccccc3C2=O)ccc1N.N#Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C20H23N3O2.C7H4N4O4/c1-14-13-15(9-10-18(14)21)22(2)11-5-6-12-23-19(24)16-7-3-4-8-17(16)20(23)25;8-3-4-1-5(10(12)13)2-6(7(4)9)11(14)15/h3-4,7-10,13H,5-6,11-12,21H2,1-2H3;1-2H,9H2 |
| InChIKey | IMOUJIGNACGOJR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 202.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|