C26H26N6O4S — CID 143749209
2-[2-(4-amino-N,3-dimethylanilino)propyl]isoindole-1,3-dione;5-nitro-2,1-benzothiazol-3-amine (PubChem CID 143749209) has the molecular formula C26H26N6O4S and a molecular weight of 518.60 g/mol. Its IUPAC name is 2-[2-(4-amino-N,3-dimethylanilino)propyl]isoindole-1,3-dione;5-nitro-2,1-benzothiazol-3-amine.
| Compound Name | 2-[2-(4-amino-N,3-dimethylanilino)propyl]isoindole-1,3-dione;5-nitro-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 143749209 |
| Molecular Formula | C26H26N6O4S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 2-[2-(4-amino-N,3-dimethylanilino)propyl]isoindole-1,3-dione;5-nitro-2,1-benzothiazol-3-amine |
| SMILES | Cc1cc(N(C)C(C)CN2C(=O)c3ccccc3C2=O)ccc1N.Nc1snc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C19H21N3O2.C7H5N3O2S/c1-12-10-14(8-9-17(12)20)21(3)13(2)11-22-18(23)15-6-4-5-7-16(15)19(22)24;8-7-5-3-4(10(11)12)1-2-6(5)9-13-7/h4-10,13H,11,20H2,1-3H3;1-3H,8H2 |
| InChIKey | LGKLLVKRWONEAR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|