C29H27N7O5S — CID 59434935
N-[5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]propanamide (PubChem CID 59434935) has the molecular formula C29H27N7O5S and a molecular weight of 585.65 g/mol. Its IUPAC name is N-[5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]propanamide.
| Compound Name | N-[5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 59434935 |
| Molecular Formula | C29H27N7O5S |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | N-[5-[3-(1,3-dioxoisoindol-2-yl)propyl-ethylamino]-2-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(N(CC)CCCN2C(=O)c3ccccc3C2=O)ccc1/N=N/c1snc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C29H27N7O5S/c1-3-26(37)30-25-17-18(34(4-2)14-7-15-35-28(38)20-8-5-6-9-21(20)29(35)39)10-13-24(25)31-32-27-22-16-19(36(40)41)11-12-23(22)33-42-27/h5-6,8-13,16-17H,3-4,7,14-15H2,1-2H3,(H,30,37)/b32-31+ |
| InChIKey | CDAFIKFJUGEWGL-QNEJGDQOSA-N |
| XLogP | 6.48 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|