C23H24N6O6S — CID 59274261
2-oxopropyl 3-[3-acetamido-N-ethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]propanoate (PubChem CID 59274261) has the molecular formula C23H24N6O6S and a molecular weight of 512.55 g/mol. Its IUPAC name is 2-oxopropyl 3-[3-acetamido-N-ethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]propanoate.
| Compound Name | 2-oxopropyl 3-[3-acetamido-N-ethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]propanoate |
|---|---|
| PubChem CID | 59274261 |
| Molecular Formula | C23H24N6O6S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 2-oxopropyl 3-[3-acetamido-N-ethyl-4-[(5-nitro-2,1-benzothiazol-3-yl)diazenyl]anilino]propanoate |
| SMILES | CCN(CCC(=O)OCC(C)=O)c1ccc(/N=N/c2snc3ccc([N+](=O)[O-])cc23)c(NC(C)=O)c1 |
| InChI | InChI=1S/C23H24N6O6S/c1-4-28(10-9-22(32)35-13-14(2)30)16-5-8-20(21(12-16)24-15(3)31)25-26-23-18-11-17(29(33)34)6-7-19(18)27-36-23/h5-8,11-12H,4,9-10,13H2,1-3H3,(H,24,31)/b26-25+ |
| InChIKey | GFFIBZMHCAUWJH-OCEACIFDSA-N |
| XLogP | 4.93 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|