C22H30N6O4S2 — CID 90138073
2-oxopropyl 3-[3-acetamido-N-butyl-4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]anilino]propanoate (PubChem CID 90138073) has the molecular formula C22H30N6O4S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-oxopropyl 3-[3-acetamido-N-butyl-4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]anilino]propanoate.
| Compound Name | 2-oxopropyl 3-[3-acetamido-N-butyl-4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]anilino]propanoate |
|---|---|
| PubChem CID | 90138073 |
| Molecular Formula | C22H30N6O4S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-oxopropyl 3-[3-acetamido-N-butyl-4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]anilino]propanoate |
| SMILES | CCCCN(CCC(=O)OCC(C)=O)c1ccc(/N=N/c2nnc(SCC)s2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C22H30N6O4S2/c1-5-7-11-28(12-10-20(31)32-14-15(3)29)17-8-9-18(19(13-17)23-16(4)30)24-25-21-26-27-22(34-21)33-6-2/h8-9,13H,5-7,10-12,14H2,1-4H3,(H,23,30)/b25-24+ |
| InChIKey | KYKPGEPBNVVJTQ-OCOZRVBESA-N |
| XLogP | 5.15 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|