C19H23N7O2S2 — CID 23390922
N-[5-[butan-2-yl(3-oxopropyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide (PubChem CID 23390922) has the molecular formula C19H23N7O2S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[5-[butan-2-yl(3-oxopropyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[butan-2-yl(3-oxopropyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23390922 |
| Molecular Formula | C19H23N7O2S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[5-[butan-2-yl(3-oxopropyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
| SMILES | [C-]#[N+]CSc1nnc(/N=N/c2ccc(N(CCC=O)C(C)CC)cc2NC(C)=O)s1 |
| InChI | InChI=1S/C19H23N7O2S2/c1-5-13(2)26(9-6-10-27)15-7-8-16(17(11-15)21-14(3)28)22-23-18-24-25-19(30-18)29-12-20-4/h7-8,10-11,13H,5-6,9,12H2,1-3H3,(H,21,28)/b23-22+ |
| InChIKey | ZUIQHWNEFSJPEG-GHVJWSGMSA-N |
| XLogP | 5.07 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|