C20H27N7O4S2 — CID 23215017
N-[5-[1-(1-cyanoethoxy)propan-2-yl-ethylamino]-2-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide (PubChem CID 23215017) has the molecular formula C20H27N7O4S2 and a molecular weight of 493.62 g/mol. Its IUPAC name is N-[5-[1-(1-cyanoethoxy)propan-2-yl-ethylamino]-2-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[1-(1-cyanoethoxy)propan-2-yl-ethylamino]-2-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23215017 |
| Molecular Formula | C20H27N7O4S2 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[5-[1-(1-cyanoethoxy)propan-2-yl-ethylamino]-2-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide |
| SMILES | CCN(c1ccc(/N=N/c2nnc(S(=O)(=O)CC)s2)c(NC(C)=O)c1)C(C)COC(C)C#N |
| InChI | InChI=1S/C20H27N7O4S2/c1-6-27(13(3)12-31-14(4)11-21)16-8-9-17(18(10-16)22-15(5)28)23-24-19-25-26-20(32-19)33(29,30)7-2/h8-10,13-14H,6-7,12H2,1-5H3,(H,22,28)/b24-23+ |
| InChIKey | YJOLJTQPRLXROL-WCWDXBQESA-N |
| XLogP | 3.85 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|