C21H23ClN6O3S — CID 101136112
ethyl (E)-3-[2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-4-chloro-1,3-thiazol-5-yl]-2-cyanoprop-2-enoate (PubChem CID 101136112) has the molecular formula C21H23ClN6O3S and a molecular weight of 474.97 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-4-chloro-1,3-thiazol-5-yl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-4-chloro-1,3-thiazol-5-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 101136112 |
| Molecular Formula | C21H23ClN6O3S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | ethyl (E)-3-[2-[[2-acetamido-4-(diethylamino)phenyl]diazenyl]-4-chloro-1,3-thiazol-5-yl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1sc(/N=N/c2ccc(N(CC)CC)cc2NC(C)=O)nc1Cl |
| InChI | InChI=1S/C21H23ClN6O3S/c1-5-28(6-2)15-8-9-16(17(11-15)24-13(4)29)26-27-21-25-19(22)18(32-21)10-14(12-23)20(30)31-7-3/h8-11H,5-7H2,1-4H3,(H,24,29)/b14-10+,27-26+ |
| InChIKey | YKVONKFGZNJRRK-PZURFKBJSA-N |
| XLogP | 5.49 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|