C18H18N8O — CID 59270629
N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dimethylamino)phenyl]acetamide (PubChem CID 59270629) has the molecular formula C18H18N8O and a molecular weight of 362.40 g/mol. Its IUPAC name is N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dimethylamino)phenyl]acetamide.
| Compound Name | N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 59270629 |
| Molecular Formula | C18H18N8O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dimethylamino)phenyl]acetamide |
| SMILES | [C-]#[N+]c1nc(/N=N/c2ccc(N(C)C)cc2NC(C)=O)n(CC=C)c1[N+]#[C-] |
| InChI | InChI=1S/C18H18N8O/c1-7-10-26-17(20-4)16(19-3)22-18(26)24-23-14-9-8-13(25(5)6)11-15(14)21-12(2)27/h7-9,11H,1,10H2,2,5-6H3,(H,21,27)/b24-23+ |
| InChIKey | JXIULXZOAPKPGP-WCWDXBQESA-N |
| XLogP | 4.61 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|