C18H23N5O2S2 — CID 88874957
hexyl 2-[[5-[[2-methyl-4-(methylideneamino)phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 88874957) has the molecular formula C18H23N5O2S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is hexyl 2-[[5-[[2-methyl-4-(methylideneamino)phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | hexyl 2-[[5-[[2-methyl-4-(methylideneamino)phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 88874957 |
| Molecular Formula | C18H23N5O2S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | hexyl 2-[[5-[[2-methyl-4-(methylideneamino)phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | C=Nc1ccc(/N=N/c2nnc(SCC(=O)OCCCCCC)s2)c(C)c1 |
| InChI | InChI=1S/C18H23N5O2S2/c1-4-5-6-7-10-25-16(24)12-26-18-23-22-17(27-18)21-20-15-9-8-14(19-3)11-13(15)2/h8-9,11H,3-7,10,12H2,1-2H3/b21-20+ |
| InChIKey | CBPNUGKQMULMEF-QZQOTICOSA-N |
| XLogP | 5.81 |
| TPSA | 89.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|