C16H27N3O4S — CID 23382875
[2-acetamido-4-(dibutylamino)phenyl]sulfamic acid (PubChem CID 23382875) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is [2-acetamido-4-(dibutylamino)phenyl]sulfamic acid.
| Compound Name | [2-acetamido-4-(dibutylamino)phenyl]sulfamic acid |
|---|---|
| PubChem CID | 23382875 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [2-acetamido-4-(dibutylamino)phenyl]sulfamic acid |
| SMILES | CCCCN(CCCC)c1ccc(NS(=O)(=O)O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C16H27N3O4S/c1-4-6-10-19(11-7-5-2)14-8-9-15(18-24(21,22)23)16(12-14)17-13(3)20/h8-9,12,18H,4-7,10-11H2,1-3H3,(H,17,20)(H,21,22,23) |
| InChIKey | TYTXKYRBBZUKAD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|