C17H16N4O2S — CID 18716010
(4-butan-2-ylphenyl)-(5-nitro-2,1-benzothiazol-3-yl)diazene (PubChem CID 18716010) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(5-nitro-2,1-benzothiazol-3-yl)diazene.
| Compound Name | (4-butan-2-ylphenyl)-(5-nitro-2,1-benzothiazol-3-yl)diazene |
|---|---|
| PubChem CID | 18716010 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (4-butan-2-ylphenyl)-(5-nitro-2,1-benzothiazol-3-yl)diazene |
| SMILES | CCC(C)c1ccc(/N=N/c2snc3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c1-3-11(2)12-4-6-13(7-5-12)18-19-17-15-10-14(21(22)23)8-9-16(15)20-24-17/h4-11H,3H2,1-2H3/b19-18+ |
| InChIKey | CXJMXXFLWXHGIR-VHEBQXMUSA-N |
| XLogP | 6.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|