C30H33NO4 — CID 10479894
methyl 3-[7-(1,3-dioxoisoindol-2-yl)heptyl]-7-propan-2-ylazulene-1-carboxylate (PubChem CID 10479894) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is methyl 3-[7-(1,3-dioxoisoindol-2-yl)heptyl]-7-propan-2-ylazulene-1-carboxylate.
| Compound Name | methyl 3-[7-(1,3-dioxoisoindol-2-yl)heptyl]-7-propan-2-ylazulene-1-carboxylate |
|---|---|
| PubChem CID | 10479894 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | methyl 3-[7-(1,3-dioxoisoindol-2-yl)heptyl]-7-propan-2-ylazulene-1-carboxylate |
| SMILES | COC(=O)c1cc(CCCCCCCN2C(=O)c3ccccc3C2=O)c2cccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C30H33NO4/c1-20(2)21-13-11-16-23-22(19-27(26(23)18-21)30(34)35-3)12-7-5-4-6-10-17-31-28(32)24-14-8-9-15-25(24)29(31)33/h8-9,11,13-16,18-20H,4-7,10,12,17H2,1-3H3 |
| InChIKey | GAVRNOYPGILJLO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|