C25H27N3O8 — CID 170921437
methyl 2-[[5-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxopentan-2-yl]diazenyl]-4,5-dimethoxybenzoate (PubChem CID 170921437) has the molecular formula C25H27N3O8 and a molecular weight of 497.50 g/mol. Its IUPAC name is methyl 2-[[5-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxopentan-2-yl]diazenyl]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[[5-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxopentan-2-yl]diazenyl]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 170921437 |
| Molecular Formula | C25H27N3O8 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | methyl 2-[[5-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxopentan-2-yl]diazenyl]-4,5-dimethoxybenzoate |
| SMILES | CCOC(=O)C(CCCN1C(=O)c2ccccc2C1=O)/N=N/c1cc(OC)c(OC)cc1C(=O)OC |
| InChI | InChI=1S/C25H27N3O8/c1-5-36-25(32)18(11-8-12-28-22(29)15-9-6-7-10-16(15)23(28)30)26-27-19-14-21(34-3)20(33-2)13-17(19)24(31)35-4/h6-7,9-10,13-14,18H,5,8,11-12H2,1-4H3/b27-26+ |
| InChIKey | WLANXFUKMBXEMY-CYYJNZCTSA-N |
| XLogP | 3.58 |
| TPSA | 133.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|