C15H13ClN2OS2 — CID 4167031
2-[2-chloro-1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedinitrile (PubChem CID 4167031) has the molecular formula C15H13ClN2OS2 and a molecular weight of 336.87 g/mol. Its IUPAC name is 2-[2-chloro-1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[2-chloro-1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 4167031 |
| Molecular Formula | C15H13ClN2OS2 |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-[2-chloro-1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedinitrile |
| SMILES | COc1ccc(C(=C(C#N)C#N)C(Cl)=C(SC)SC)cc1 |
| InChI | InChI=1S/C15H13ClN2OS2/c1-19-12-6-4-10(5-7-12)13(11(8-17)9-18)14(16)15(20-2)21-3/h4-7H,1-3H3 |
| InChIKey | KFHDQTNQCBDDCI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|