C17H14N2O5 — CID 11347952
dimethyl (E)-2-[2,2-dicyano-1-(4-methoxyphenyl)ethenyl]but-2-enedioate (PubChem CID 11347952) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is dimethyl (E)-2-[2,2-dicyano-1-(4-methoxyphenyl)ethenyl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2,2-dicyano-1-(4-methoxyphenyl)ethenyl]but-2-enedioate |
|---|---|
| PubChem CID | 11347952 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | dimethyl (E)-2-[2,2-dicyano-1-(4-methoxyphenyl)ethenyl]but-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)C(=C(C#N)C#N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H14N2O5/c1-22-13-6-4-11(5-7-13)16(12(9-18)10-19)14(17(21)24-3)8-15(20)23-2/h4-8H,1-3H3/b14-8+ |
| InChIKey | YECVLWOLPJDHMU-RIYZIHGNSA-N |
| XLogP | 1.77 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|