C24H16N4O2 — CID 102136285
(3E)-2,5-bis(4-methoxyphenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile (PubChem CID 102136285) has the molecular formula C24H16N4O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is (3E)-2,5-bis(4-methoxyphenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile.
| Compound Name | (3E)-2,5-bis(4-methoxyphenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile |
|---|---|
| PubChem CID | 102136285 |
| Molecular Formula | C24H16N4O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (3E)-2,5-bis(4-methoxyphenyl)hexa-1,3,5-triene-1,1,6,6-tetracarbonitrile |
| SMILES | COc1ccc(C(/C=C/C(=C(C#N)C#N)c2ccc(OC)cc2)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C24H16N4O2/c1-29-21-7-3-17(4-8-21)23(19(13-25)14-26)11-12-24(20(15-27)16-28)18-5-9-22(30-2)10-6-18/h3-12H,1-2H3/b12-11+ |
| InChIKey | OESOMMRKNABXDI-VAWYXSNFSA-N |
| XLogP | 4.56 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|