C16H11Cl2NO — CID 22302618
(E)-3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile (PubChem CID 22302618) has the molecular formula C16H11Cl2NO and a molecular weight of 304.18 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 22302618 |
| Molecular Formula | C16H11Cl2NO |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C(C#N)=C\c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2NO/c1-20-13-7-5-11(6-8-13)12(10-19)9-14-15(17)3-2-4-16(14)18/h2-9H,1H3/b12-9- |
| InChIKey | IQJXZHBFVJVVPU-XFXZXTDPSA-N |
| XLogP | 5.07 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|