C15H14N2O — CID 143449898
(Z)-3-(3,4-dihydropyridin-6-yl)-2-(4-methoxyphenyl)prop-2-enenitrile (PubChem CID 143449898) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydropyridin-6-yl)-2-(4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,4-dihydropyridin-6-yl)-2-(4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 143449898 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (Z)-3-(3,4-dihydropyridin-6-yl)-2-(4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C(C#N)=C/C2=CCCC=N2)cc1 |
| InChI | InChI=1S/C15H14N2O/c1-18-15-7-5-12(6-8-15)13(11-16)10-14-4-2-3-9-17-14/h4-10H,2-3H2,1H3/b13-10+ |
| InChIKey | NONFPZPFLNKCIL-JLHYYAGUSA-N |
| XLogP | 3.35 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|