C16H15N3O3S — CID 23508390
1-[(Z)-2-cyano-2-[4-(sulfamoylamino)phenyl]ethenyl]-4-methoxybenzene (PubChem CID 23508390) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-2-[4-(sulfamoylamino)phenyl]ethenyl]-4-methoxybenzene.
| Compound Name | 1-[(Z)-2-cyano-2-[4-(sulfamoylamino)phenyl]ethenyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 23508390 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[(Z)-2-cyano-2-[4-(sulfamoylamino)phenyl]ethenyl]-4-methoxybenzene |
| SMILES | COc1ccc(/C=C(\C#N)c2ccc(NS(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H15N3O3S/c1-22-16-8-2-12(3-9-16)10-14(11-17)13-4-6-15(7-5-13)19-23(18,20)21/h2-10,19H,1H3,(H2,18,20,21)/b14-10+ |
| InChIKey | ZXDUOGCUYSDDHI-GXDHUFHOSA-N |
| XLogP | 2.37 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|