C18H18N2O5S — CID 68942999
(Z)-1-cyano-2-(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)ethenesulfonamide (PubChem CID 68942999) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is (Z)-1-cyano-2-(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)ethenesulfonamide.
| Compound Name | (Z)-1-cyano-2-(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 68942999 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (Z)-1-cyano-2-(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)ethenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)/C(C#N)=C\c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-23-15-6-4-14(5-7-15)20-26(21,22)18(12-19)10-13-8-16(24-2)11-17(9-13)25-3/h4-11,20H,1-3H3/b18-10- |
| InChIKey | RDHFJZFUVYWOBG-ZDLGFXPLSA-N |
| XLogP | 3.02 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|