C11H12N2O3S2 — CID 68947212
1-cyano-N-(4-methoxyphenyl)-2-methylsulfanylethenesulfonamide (PubChem CID 68947212) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-cyano-N-(4-methoxyphenyl)-2-methylsulfanylethenesulfonamide.
| Compound Name | 1-cyano-N-(4-methoxyphenyl)-2-methylsulfanylethenesulfonamide |
|---|---|
| PubChem CID | 68947212 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 1-cyano-N-(4-methoxyphenyl)-2-methylsulfanylethenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)C(C#N)=CSC)cc1 |
| InChI | InChI=1S/C11H12N2O3S2/c1-16-10-5-3-9(4-6-10)13-18(14,15)11(7-12)8-17-2/h3-6,8,13H,1-2H3 |
| InChIKey | HGRAFQYFCSZDFK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|