C20H22N2O3S — CID 7711848
3-(4-butylanilino)-2-(4-methoxyphenyl)sulfonylprop-2-enenitrile (PubChem CID 7711848) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-(4-butylanilino)-2-(4-methoxyphenyl)sulfonylprop-2-enenitrile.
| Compound Name | 3-(4-butylanilino)-2-(4-methoxyphenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 7711848 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(4-butylanilino)-2-(4-methoxyphenyl)sulfonylprop-2-enenitrile |
| SMILES | CCCCc1ccc(NC=C(C#N)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-4-5-16-6-8-17(9-7-16)22-15-20(14-21)26(23,24)19-12-10-18(25-2)11-13-19/h6-13,15,22H,3-5H2,1-2H3 |
| InChIKey | NOQRUXFQCZVJFW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|