C20H21NO6S — CID 68943321
2-[(4-methoxyphenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 68943321) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[(4-methoxyphenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68943321 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(CS(=O)(=O)C(C#N)=Cc2c(OC)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H21NO6S/c1-24-15-7-5-14(6-8-15)13-28(22,23)17(12-21)11-18-19(26-3)9-16(25-2)10-20(18)27-4/h5-11H,13H2,1-4H3 |
| InChIKey | UBHNJZPRVVQMOC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|