C17H13FN2O5S — CID 68943900
(Z)-3-(4-fluoro-3-nitrophenyl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile (PubChem CID 68943900) has the molecular formula C17H13FN2O5S and a molecular weight of 376.37 g/mol. Its IUPAC name is (Z)-3-(4-fluoro-3-nitrophenyl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(4-fluoro-3-nitrophenyl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 68943900 |
| Molecular Formula | C17H13FN2O5S |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (Z)-3-(4-fluoro-3-nitrophenyl)-2-[(4-methoxyphenyl)methylsulfonyl]prop-2-enenitrile |
| SMILES | COc1ccc(CS(=O)(=O)/C(C#N)=C\c2ccc(F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H13FN2O5S/c1-25-14-5-2-12(3-6-14)11-26(23,24)15(10-19)8-13-4-7-16(18)17(9-13)20(21)22/h2-9H,11H2,1H3/b15-8- |
| InChIKey | CLZXRCQWARUPKC-NVNXTCNLSA-N |
| XLogP | 3.22 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|