C15H6F6N2O2S — CID 25052537
(E)-1-cyano-N-(4-fluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide (PubChem CID 25052537) has the molecular formula C15H6F6N2O2S and a molecular weight of 392.28 g/mol. Its IUPAC name is (E)-1-cyano-N-(4-fluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-(4-fluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 25052537 |
| Molecular Formula | C15H6F6N2O2S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | (E)-1-cyano-N-(4-fluorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide |
| SMILES | N#C/C(=C\c1c(F)c(F)c(F)c(F)c1F)S(=O)(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H6F6N2O2S/c16-7-1-3-8(4-2-7)23-26(24,25)9(6-22)5-10-11(17)13(19)15(21)14(20)12(10)18/h1-5,23H/b9-5+ |
| InChIKey | KSDDJEPXXSAMJD-WEVVVXLNSA-N |
| XLogP | 3.83 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|